C10H21NO2 — CID 175053297
N,N-dimethylprop-1-en-1-amine;1-ethoxypropan-2-one (PubChem CID 175053297) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is N,N-dimethylprop-1-en-1-amine;1-ethoxypropan-2-one.
| Compound Name | N,N-dimethylprop-1-en-1-amine;1-ethoxypropan-2-one |
|---|---|
| PubChem CID | 175053297 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | N,N-dimethylprop-1-en-1-amine;1-ethoxypropan-2-one |
| SMILES | CC=CN(C)C.CCOCC(C)=O |
| InChI | InChI=1S/C5H11N.C5H10O2/c1-4-5-6(2)3;1-3-7-4-5(2)6/h4-5H,1-3H3;3-4H2,1-2H3 |
| InChIKey | QFLBGBBVNDZBMD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |