About magnesium;methanolate;acetate
magnesium;methanolate;acetate (PubChem CID 140982127) has the molecular formula C3H6MgO3
and a molecular weight of 114.38 g/mol. Its IUPAC name is magnesium;methanolate;acetate.
Molecular Properties
| Compound Name | magnesium;methanolate;acetate |
| PubChem CID | 140982127 |
| Molecular Formula | C3H6MgO3 |
| Molecular Weight | 114.38 g/mol |
| Exact Mass | 114.02 |
| IUPAC Name | magnesium;methanolate;acetate |
| SMILES | CC(=O)[O-].C[O-].[Mg+2] |
| InChI | InChI=1S/C2H4O2.CH3O.Mg/c1-2(3)4;1-2;/h1H3,(H,3,4);1H3;/q;-1;+2/p-1 |
| InChIKey | MONLKAMRZWJODZ-UHFFFAOYSA-M |
| XLogP | -2.65 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.38 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze magnesium;methanolate;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;methanolate;acetate?
The IUPAC name of magnesium;methanolate;acetate (CID 140982127) is magnesium;methanolate;acetate.
What is the SMILES notation for magnesium;methanolate;acetate?
The canonical SMILES for magnesium;methanolate;acetate is CC(=O)[O-].C[O-].[Mg+2].
What is the InChIKey of magnesium;methanolate;acetate?
The InChIKey is MONLKAMRZWJODZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.CH3O.Mg/c1-2(3)4;1-2;/h1H3,(H,3,4);1H3;/q;-1;+2/p-1.
What are the key properties of magnesium;methanolate;acetate?
magnesium;methanolate;acetate has a molecular weight of 114.38 g/mol, XLogP of -2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;methanolate;acetate is sourced from PubChem (CID 140982127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).