C10H14Br2O2 — CID 102121537
(E)-2,3-dibromo-1,4-bis(prop-2-enoxy)but-2-ene (PubChem CID 102121537) has the molecular formula C10H14Br2O2 and a molecular weight of 326.03 g/mol. Its IUPAC name is (E)-2,3-dibromo-1,4-bis(prop-2-enoxy)but-2-ene.
| Compound Name | (E)-2,3-dibromo-1,4-bis(prop-2-enoxy)but-2-ene |
|---|---|
| PubChem CID | 102121537 |
| Molecular Formula | C10H14Br2O2 |
| Molecular Weight | 326.03 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | (E)-2,3-dibromo-1,4-bis(prop-2-enoxy)but-2-ene |
| SMILES | C=CCOC/C(Br)=C(\Br)COCC=C |
| InChI | InChI=1S/C10H14Br2O2/c1-3-5-13-7-9(11)10(12)8-14-6-4-2/h3-4H,1-2,5-8H2/b10-9+ |
| InChIKey | ORSMWUIFKCBSHC-MDZDMXLPSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.03 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|