C12H19BrO — CID 15657332
(2Z,4E)-2-bromo-6,6-dimethyl-1-prop-2-enoxyhepta-2,4-diene (PubChem CID 15657332) has the molecular formula C12H19BrO and a molecular weight of 259.19 g/mol. Its IUPAC name is (2Z,4E)-2-bromo-6,6-dimethyl-1-prop-2-enoxyhepta-2,4-diene.
| Compound Name | (2Z,4E)-2-bromo-6,6-dimethyl-1-prop-2-enoxyhepta-2,4-diene |
|---|---|
| PubChem CID | 15657332 |
| Molecular Formula | C12H19BrO |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | (2Z,4E)-2-bromo-6,6-dimethyl-1-prop-2-enoxyhepta-2,4-diene |
| SMILES | C=CCOC/C(Br)=C/C=C/C(C)(C)C |
| InChI | InChI=1S/C12H19BrO/c1-5-9-14-10-11(13)7-6-8-12(2,3)4/h5-8H,1,9-10H2,2-4H3/b8-6+,11-7- |
| InChIKey | KZWNSAFJQXPYRL-VJUDZZRDSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|