C8H14O5 — CID 54142770
(3S,4S)-3,4,5-trihydroxy-1-prop-2-enoxypentan-2-one (PubChem CID 54142770) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is (3S,4S)-3,4,5-trihydroxy-1-prop-2-enoxypentan-2-one.
| Compound Name | (3S,4S)-3,4,5-trihydroxy-1-prop-2-enoxypentan-2-one |
|---|---|
| PubChem CID | 54142770 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (3S,4S)-3,4,5-trihydroxy-1-prop-2-enoxypentan-2-one |
| SMILES | C=CCOCC(=O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C8H14O5/c1-2-3-13-5-7(11)8(12)6(10)4-9/h2,6,8-10,12H,1,3-5H2/t6-,8-/m0/s1 |
| InChIKey | OCFWKPJOYRRYCS-XPUUQOCRSA-N |
| XLogP | -1.53 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|