C10H16O5 — CID 155660539
2,3-dihydroxypropyl 2-(prop-2-enoxymethyl)prop-2-enoate (PubChem CID 155660539) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-(prop-2-enoxymethyl)prop-2-enoate.
| Compound Name | 2,3-dihydroxypropyl 2-(prop-2-enoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 155660539 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2,3-dihydroxypropyl 2-(prop-2-enoxymethyl)prop-2-enoate |
| SMILES | C=CCOCC(=C)C(=O)OCC(O)CO |
| InChI | InChI=1S/C10H16O5/c1-3-4-14-6-8(2)10(13)15-7-9(12)5-11/h3,9,11-12H,1-2,4-7H2 |
| InChIKey | KVRRZAGBDZXAPF-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|