C22H42O11 — CID 161151376
2,2-bis(hydroxymethyl)butanoic acid;2,3-dihydroxypropyl 2-methylprop-2-enoate;2-ethyl-2-(prop-2-enoxymethyl)propane-1,3-diol (PubChem CID 161151376) has the molecular formula C22H42O11 and a molecular weight of 482.57 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)butanoic acid;2,3-dihydroxypropyl 2-methylprop-2-enoate;2-ethyl-2-(prop-2-enoxymethyl)propane-1,3-diol.
| Compound Name | 2,2-bis(hydroxymethyl)butanoic acid;2,3-dihydroxypropyl 2-methylprop-2-enoate;2-ethyl-2-(prop-2-enoxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 161151376 |
| Molecular Formula | C22H42O11 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 2,2-bis(hydroxymethyl)butanoic acid;2,3-dihydroxypropyl 2-methylprop-2-enoate;2-ethyl-2-(prop-2-enoxymethyl)propane-1,3-diol |
| SMILES | C=C(C)C(=O)OCC(O)CO.C=CCOCC(CC)(CO)CO.CCC(CO)(CO)C(=O)O |
| InChI | InChI=1S/C9H18O3.C7H12O4.C6H12O4/c1-3-5-12-8-9(4-2,6-10)7-11;1-5(2)7(10)11-4-6(9)3-8;1-2-6(3-7,4-8)5(9)10/h3,10-11H,1,4-8H2,2H3;6,8-9H,1,3-4H2,2H3;7-8H,2-4H2,1H3,(H,9,10) |
| InChIKey | UOSKPAUHJWJVBF-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|