C15H28O7 — CID 6454241
2-ethyl-2-(prop-2-enoxymethyl)propane-1,3-diol;hexanedioic acid (PubChem CID 6454241) has the molecular formula C15H28O7 and a molecular weight of 320.38 g/mol. Its IUPAC name is 2-ethyl-2-(prop-2-enoxymethyl)propane-1,3-diol;hexanedioic acid.
| Compound Name | 2-ethyl-2-(prop-2-enoxymethyl)propane-1,3-diol;hexanedioic acid |
|---|---|
| PubChem CID | 6454241 |
| Molecular Formula | C15H28O7 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-ethyl-2-(prop-2-enoxymethyl)propane-1,3-diol;hexanedioic acid |
| SMILES | C=CCOCC(CC)(CO)CO.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C9H18O3.C6H10O4/c1-3-5-12-8-9(4-2,6-10)7-11;7-5(8)3-1-2-4-6(9)10/h3,10-11H,1,4-8H2,2H3;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | WGIUMUPNZRABPX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|