C22H44O8 — CID 87751704
decanoic acid;7-[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]heptanoic acid (PubChem CID 87751704) has the molecular formula C22H44O8 and a molecular weight of 436.59 g/mol. Its IUPAC name is decanoic acid;7-[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]heptanoic acid.
| Compound Name | decanoic acid;7-[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]heptanoic acid |
|---|---|
| PubChem CID | 87751704 |
| Molecular Formula | C22H44O8 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | decanoic acid;7-[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]heptanoic acid |
| SMILES | CCCCCCCCCC(=O)O.O=C(O)CCCCCCOCC(CO)(CO)CO |
| InChI | InChI=1S/C12H24O6.C10H20O2/c13-7-12(8-14,9-15)10-18-6-4-2-1-3-5-11(16)17;1-2-3-4-5-6-7-8-9-10(11)12/h13-15H,1-10H2,(H,16,17);2-9H2,1H3,(H,11,12) |
| InChIKey | WFJPAJHPCJRXKF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|