C14H26O5 — CID 141198690
3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propan-1-ol;hydrate (PubChem CID 141198690) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propan-1-ol;hydrate.
| Compound Name | 3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propan-1-ol;hydrate |
|---|---|
| PubChem CID | 141198690 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propan-1-ol;hydrate |
| SMILES | C=CCOCC(CO)(COCC=C)COCC=C.O |
| InChI | InChI=1S/C14H24O4.H2O/c1-4-7-16-11-14(10-15,12-17-8-5-2)13-18-9-6-3;/h4-6,15H,1-3,7-13H2;1H2 |
| InChIKey | QICZYYYGPFTKTH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|