C17H24O6 — CID 155625651
[2,2-bis(prop-2-enoxymethyl)-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 155625651) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is [2,2-bis(prop-2-enoxymethyl)-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2,2-bis(prop-2-enoxymethyl)-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 155625651 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [2,2-bis(prop-2-enoxymethyl)-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CCOCC(COCC=C)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C17H24O6/c1-5-9-20-11-17(12-21-10-6-2,13-22-15(18)7-3)14-23-16(19)8-4/h5-8H,1-4,9-14H2 |
| InChIKey | CUVQFOBMHATRAN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|