C28H44O9 — CID 22894306
[2-but-3-enyl-2-[[3-(ethenoxymethoxy)-2,2-bis(ethenoxymethoxymethyl)propoxy]methyl]hex-5-enyl] prop-2-enoate (PubChem CID 22894306) has the molecular formula C28H44O9 and a molecular weight of 524.65 g/mol. Its IUPAC name is [2-but-3-enyl-2-[[3-(ethenoxymethoxy)-2,2-bis(ethenoxymethoxymethyl)propoxy]methyl]hex-5-enyl] prop-2-enoate.
| Compound Name | [2-but-3-enyl-2-[[3-(ethenoxymethoxy)-2,2-bis(ethenoxymethoxymethyl)propoxy]methyl]hex-5-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 22894306 |
| Molecular Formula | C28H44O9 |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | [2-but-3-enyl-2-[[3-(ethenoxymethoxy)-2,2-bis(ethenoxymethoxymethyl)propoxy]methyl]hex-5-enyl] prop-2-enoate |
| SMILES | C=CCCC(CCC=C)(COCC(COCOC=C)(COCOC=C)COCOC=C)COC(=O)C=C |
| InChI | InChI=1S/C28H44O9/c1-7-13-15-27(16-14-8-2,22-37-26(29)9-3)17-33-18-28(19-34-23-30-10-4,20-35-24-31-11-5)21-36-25-32-12-6/h7-12H,1-6,13-25H2 |
| InChIKey | IFRLFIXVSQPNPD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|