C21H28O12 — CID 20770060
[2-(2-acetyloxyprop-2-enoyloxymethyl)-3-(ethenoxymethoxy)-2-(ethenoxymethoxymethyl)propyl] 2-acetyloxyprop-2-enoate (PubChem CID 20770060) has the molecular formula C21H28O12 and a molecular weight of 472.44 g/mol. Its IUPAC name is [2-(2-acetyloxyprop-2-enoyloxymethyl)-3-(ethenoxymethoxy)-2-(ethenoxymethoxymethyl)propyl] 2-acetyloxyprop-2-enoate.
| Compound Name | [2-(2-acetyloxyprop-2-enoyloxymethyl)-3-(ethenoxymethoxy)-2-(ethenoxymethoxymethyl)propyl] 2-acetyloxyprop-2-enoate |
|---|---|
| PubChem CID | 20770060 |
| Molecular Formula | C21H28O12 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [2-(2-acetyloxyprop-2-enoyloxymethyl)-3-(ethenoxymethoxy)-2-(ethenoxymethoxymethyl)propyl] 2-acetyloxyprop-2-enoate |
| SMILES | C=COCOCC(COCOC=C)(COC(=O)C(=C)OC(C)=O)COC(=O)C(=C)OC(C)=O |
| InChI | InChI=1S/C21H28O12/c1-7-26-13-28-9-21(10-29-14-27-8-2,11-30-19(24)15(3)32-17(5)22)12-31-20(25)16(4)33-18(6)23/h7-8H,1-4,9-14H2,5-6H3 |
| InChIKey | MMDABZRXUWPFIS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|