C41H66N4O18 — CID 22894275
[2,2-bis[[2-acetamido-3-(ethenoxymethoxy)propoxy]methoxymethyl]-3-(3-acetamido-4-prop-2-enoyloxybutanoyl)oxypropyl] 3-acetamidohept-6-enoate (PubChem CID 22894275) has the molecular formula C41H66N4O18 and a molecular weight of 902.99 g/mol. Its IUPAC name is [2,2-bis[[2-acetamido-3-(ethenoxymethoxy)propoxy]methoxymethyl]-3-(3-acetamido-4-prop-2-enoyloxybutanoyl)oxypropyl] 3-acetamidohept-6-enoate.
| Compound Name | [2,2-bis[[2-acetamido-3-(ethenoxymethoxy)propoxy]methoxymethyl]-3-(3-acetamido-4-prop-2-enoyloxybutanoyl)oxypropyl] 3-acetamidohept-6-enoate |
|---|---|
| PubChem CID | 22894275 |
| Molecular Formula | C41H66N4O18 |
| Molecular Weight | 902.99 g/mol |
| Exact Mass | 902.44 |
| IUPAC Name | [2,2-bis[[2-acetamido-3-(ethenoxymethoxy)propoxy]methoxymethyl]-3-(3-acetamido-4-prop-2-enoyloxybutanoyl)oxypropyl] 3-acetamidohept-6-enoate |
| SMILES | C=CCCC(CC(=O)OCC(COCOCC(COCOC=C)NC(C)=O)(COCOCC(COCOC=C)NC(C)=O)COC(=O)CC(COC(=O)C=C)NC(C)=O)NC(C)=O |
| InChI | InChI=1S/C41H66N4O18/c1-9-13-14-34(42-30(5)46)15-39(51)62-24-41(22-59-28-57-19-36(44-32(7)48)17-55-26-53-11-3,23-60-29-58-20-37(45-33(8)49)18-56-27-54-12-4)25-63-40(52)16-35(43-31(6)47)21-61-38(50)10-2/h9-12,34-37H,1-4,13-29H2,5-8H3,(H,42,46)(H,43,47)(H,44,48)(H,45,49) |
| InChIKey | JSQOPYUCEATXDG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 269.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.99 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|