C24H34O9 — CID 155665786
2,2-bis(prop-2-enoyloxymethyl)butoxymethyl 2-methylidene-4-(prop-2-enoyloxymethyl)hexanoate (PubChem CID 155665786) has the molecular formula C24H34O9 and a molecular weight of 466.53 g/mol. Its IUPAC name is 2,2-bis(prop-2-enoyloxymethyl)butoxymethyl 2-methylidene-4-(prop-2-enoyloxymethyl)hexanoate.
| Compound Name | 2,2-bis(prop-2-enoyloxymethyl)butoxymethyl 2-methylidene-4-(prop-2-enoyloxymethyl)hexanoate |
|---|---|
| PubChem CID | 155665786 |
| Molecular Formula | C24H34O9 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 2,2-bis(prop-2-enoyloxymethyl)butoxymethyl 2-methylidene-4-(prop-2-enoyloxymethyl)hexanoate |
| SMILES | C=CC(=O)OCC(CC)CC(=C)C(=O)OCOCC(CC)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C24H34O9/c1-7-19(13-30-20(25)8-2)12-18(6)23(28)33-17-29-14-24(11-5,15-31-21(26)9-3)16-32-22(27)10-4/h8-10,19H,2-4,6-7,11-17H2,1,5H3 |
| InChIKey | TVODDEAFKCHANF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|