C28H36O12 — CID 118359991
methyl 2-methylidene-3-[[2-(prop-2-enoxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propoxy]methyl]-4-prop-2-enoyloxy-3-(prop-2-enoyloxymethyl)butanoate (PubChem CID 118359991) has the molecular formula C28H36O12 and a molecular weight of 564.58 g/mol. Its IUPAC name is methyl 2-methylidene-3-[[2-(prop-2-enoxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propoxy]methyl]-4-prop-2-enoyloxy-3-(prop-2-enoyloxymethyl)butanoate.
| Compound Name | methyl 2-methylidene-3-[[2-(prop-2-enoxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propoxy]methyl]-4-prop-2-enoyloxy-3-(prop-2-enoyloxymethyl)butanoate |
|---|---|
| PubChem CID | 118359991 |
| Molecular Formula | C28H36O12 |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | methyl 2-methylidene-3-[[2-(prop-2-enoxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propoxy]methyl]-4-prop-2-enoyloxy-3-(prop-2-enoyloxymethyl)butanoate |
| SMILES | C=CCOCC(COCC(COC(=O)C=C)(COC(=O)C=C)C(=C)C(=O)OC)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C28H36O12/c1-8-13-35-14-27(16-37-22(29)9-2,17-38-23(30)10-3)15-36-18-28(19-39-24(31)11-4,20-40-25(32)12-5)21(6)26(33)34-7/h8-12H,1-6,13-20H2,7H3 |
| InChIKey | XYIAGUGBEMSZPH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|