C17H26O8 — CID 139503569
[3-(oxiran-2-ylmethoxy)-2,2-bis(oxiran-2-ylmethoxymethyl)propyl] prop-2-enoate (PubChem CID 139503569) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is [3-(oxiran-2-ylmethoxy)-2,2-bis(oxiran-2-ylmethoxymethyl)propyl] prop-2-enoate.
| Compound Name | [3-(oxiran-2-ylmethoxy)-2,2-bis(oxiran-2-ylmethoxymethyl)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 139503569 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [3-(oxiran-2-ylmethoxy)-2,2-bis(oxiran-2-ylmethoxymethyl)propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COCC1CO1)(COCC1CO1)COCC1CO1 |
| InChI | InChI=1S/C17H26O8/c1-2-16(18)25-12-17(9-19-3-13-6-22-13,10-20-4-14-7-23-14)11-21-5-15-8-24-15/h2,13-15H,1,3-12H2 |
| InChIKey | HYCVLRWZCPSZJE-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 91.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|