C9H19O7P — CID 87845126
2,3-dihydroxypropyl dihydrogen phosphate;3-prop-2-enoxyprop-1-ene (PubChem CID 87845126) has the molecular formula C9H19O7P and a molecular weight of 270.22 g/mol. Its IUPAC name is 2,3-dihydroxypropyl dihydrogen phosphate;3-prop-2-enoxyprop-1-ene.
| Compound Name | 2,3-dihydroxypropyl dihydrogen phosphate;3-prop-2-enoxyprop-1-ene |
|---|---|
| PubChem CID | 87845126 |
| Molecular Formula | C9H19O7P |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2,3-dihydroxypropyl dihydrogen phosphate;3-prop-2-enoxyprop-1-ene |
| SMILES | C=CCOCC=C.O=P(O)(O)OCC(O)CO |
| InChI | InChI=1S/C6H10O.C3H9O6P/c1-3-5-7-6-4-2;4-1-3(5)2-9-10(6,7)8/h3-4H,1-2,5-6H2;3-5H,1-2H2,(H2,6,7,8) |
| InChIKey | NLBGTEGVOIDCFW-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|