C7H16O3 — CID 174709121
methane;3-prop-2-enoxypropane-1,2-diol (PubChem CID 174709121) has the molecular formula C7H16O3 and a molecular weight of 148.20 g/mol. Its IUPAC name is methane;3-prop-2-enoxypropane-1,2-diol.
| Compound Name | methane;3-prop-2-enoxypropane-1,2-diol |
|---|---|
| PubChem CID | 174709121 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | methane;3-prop-2-enoxypropane-1,2-diol |
| SMILES | C.C=CCOCC(O)CO |
| InChI | InChI=1S/C6H12O3.CH4/c1-2-3-9-5-6(8)4-7;/h2,6-8H,1,3-5H2;1H4 |
| InChIKey | WMTRCMUHLCXUDR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|