C9H18O5 — CID 129166429
2-(2-hydroxy-3-prop-2-enoxypropoxy)propane-1,3-diol (PubChem CID 129166429) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(2-hydroxy-3-prop-2-enoxypropoxy)propane-1,3-diol.
| Compound Name | 2-(2-hydroxy-3-prop-2-enoxypropoxy)propane-1,3-diol |
|---|---|
| PubChem CID | 129166429 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-(2-hydroxy-3-prop-2-enoxypropoxy)propane-1,3-diol |
| SMILES | C=CCOCC(O)COC(CO)CO |
| InChI | InChI=1S/C9H18O5/c1-2-3-13-6-8(12)7-14-9(4-10)5-11/h2,8-12H,1,3-7H2 |
| InChIKey | RQJISLDRJQPCFC-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|