C36H46O10 — CID 164786169
1-[1-[3-[2-(2-hydroxy-3-prop-2-enoxypropoxy)-3-phenoxypropoxy]phenoxy]-3-phenoxypropan-2-yl]oxy-3-prop-2-enoxypropan-2-ol (PubChem CID 164786169) has the molecular formula C36H46O10 and a molecular weight of 638.75 g/mol. Its IUPAC name is 1-[1-[3-[2-(2-hydroxy-3-prop-2-enoxypropoxy)-3-phenoxypropoxy]phenoxy]-3-phenoxypropan-2-yl]oxy-3-prop-2-enoxypropan-2-ol.
| Compound Name | 1-[1-[3-[2-(2-hydroxy-3-prop-2-enoxypropoxy)-3-phenoxypropoxy]phenoxy]-3-phenoxypropan-2-yl]oxy-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 164786169 |
| Molecular Formula | C36H46O10 |
| Molecular Weight | 638.75 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | 1-[1-[3-[2-(2-hydroxy-3-prop-2-enoxypropoxy)-3-phenoxypropoxy]phenoxy]-3-phenoxypropan-2-yl]oxy-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)COC(COc1ccccc1)COc1cccc(OCC(COc2ccccc2)OCC(O)COCC=C)c1 |
| InChI | InChI=1S/C36H46O10/c1-3-18-39-21-29(37)23-41-35(25-43-31-12-7-5-8-13-31)27-45-33-16-11-17-34(20-33)46-28-36(26-44-32-14-9-6-10-15-32)42-24-30(38)22-40-19-4-2/h3-17,20,29-30,35-38H,1-2,18-19,21-28H2 |
| InChIKey | RZVJBJYGSXIXMB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.75 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|