C42H38O8 — CID 23111038
[1-(3-phenylphenoxy)-3-[3-[3-(3-phenylphenoxy)-2-prop-2-enoyloxypropoxy]phenoxy]propan-2-yl] prop-2-enoate (PubChem CID 23111038) has the molecular formula C42H38O8 and a molecular weight of 670.76 g/mol. Its IUPAC name is [1-(3-phenylphenoxy)-3-[3-[3-(3-phenylphenoxy)-2-prop-2-enoyloxypropoxy]phenoxy]propan-2-yl] prop-2-enoate.
| Compound Name | [1-(3-phenylphenoxy)-3-[3-[3-(3-phenylphenoxy)-2-prop-2-enoyloxypropoxy]phenoxy]propan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 23111038 |
| Molecular Formula | C42H38O8 |
| Molecular Weight | 670.76 g/mol |
| Exact Mass | 670.26 |
| IUPAC Name | [1-(3-phenylphenoxy)-3-[3-[3-(3-phenylphenoxy)-2-prop-2-enoyloxypropoxy]phenoxy]propan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(COc1cccc(OCC(COc2cccc(-c3ccccc3)c2)OC(=O)C=C)c1)COc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C42H38O8/c1-3-41(43)49-39(27-45-35-20-11-18-33(24-35)31-14-7-5-8-15-31)29-47-37-22-13-23-38(26-37)48-30-40(50-42(44)4-2)28-46-36-21-12-19-34(25-36)32-16-9-6-10-17-32/h3-26,39-40H,1-2,27-30H2 |
| InChIKey | RVCKFIKVFGTYNS-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.76 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|