C22H30O6S2 — CID 91569864
[1-ethylsulfanyl-1-[3-(3-ethylsulfanyl-2-prop-2-enoyloxypropoxy)phenoxy]propan-2-yl] prop-2-enoate (PubChem CID 91569864) has the molecular formula C22H30O6S2 and a molecular weight of 454.61 g/mol. Its IUPAC name is [1-ethylsulfanyl-1-[3-(3-ethylsulfanyl-2-prop-2-enoyloxypropoxy)phenoxy]propan-2-yl] prop-2-enoate.
| Compound Name | [1-ethylsulfanyl-1-[3-(3-ethylsulfanyl-2-prop-2-enoyloxypropoxy)phenoxy]propan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 91569864 |
| Molecular Formula | C22H30O6S2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [1-ethylsulfanyl-1-[3-(3-ethylsulfanyl-2-prop-2-enoyloxypropoxy)phenoxy]propan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(COc1cccc(OC(SCC)C(C)OC(=O)C=C)c1)CSCC |
| InChI | InChI=1S/C22H30O6S2/c1-6-20(23)26-16(5)22(30-9-4)28-18-12-10-11-17(13-18)25-14-19(15-29-8-3)27-21(24)7-2/h6-7,10-13,16,19,22H,1-2,8-9,14-15H2,3-5H3 |
| InChIKey | HAFWGMHOBWUTFY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|