C14H20O7S — CID 23569655
methyl (1-phenoxy-3-prop-2-enoxypropan-2-yl)oxymethyl sulfate (PubChem CID 23569655) has the molecular formula C14H20O7S and a molecular weight of 332.37 g/mol. Its IUPAC name is methyl (1-phenoxy-3-prop-2-enoxypropan-2-yl)oxymethyl sulfate.
| Compound Name | methyl (1-phenoxy-3-prop-2-enoxypropan-2-yl)oxymethyl sulfate |
|---|---|
| PubChem CID | 23569655 |
| Molecular Formula | C14H20O7S |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | methyl (1-phenoxy-3-prop-2-enoxypropan-2-yl)oxymethyl sulfate |
| SMILES | C=CCOCC(COc1ccccc1)OCOS(=O)(=O)OC |
| InChI | InChI=1S/C14H20O7S/c1-3-9-18-10-14(20-12-21-22(15,16)17-2)11-19-13-7-5-4-6-8-13/h3-8,14H,1,9-12H2,2H3 |
| InChIKey | FKWNOBRZJYWDAG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|