C25H47NO10S — CID 91420334
butane-1,4-diol;1-butyl-4-[2-(methoxymethoxy)-3-prop-2-enoxypropoxy]benzene;(2-hydroxyethylamino) methanesulfonate (PubChem CID 91420334) has the molecular formula C25H47NO10S and a molecular weight of 553.72 g/mol. Its IUPAC name is butane-1,4-diol;1-butyl-4-[2-(methoxymethoxy)-3-prop-2-enoxypropoxy]benzene;(2-hydroxyethylamino) methanesulfonate.
| Compound Name | butane-1,4-diol;1-butyl-4-[2-(methoxymethoxy)-3-prop-2-enoxypropoxy]benzene;(2-hydroxyethylamino) methanesulfonate |
|---|---|
| PubChem CID | 91420334 |
| Molecular Formula | C25H47NO10S |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | butane-1,4-diol;1-butyl-4-[2-(methoxymethoxy)-3-prop-2-enoxypropoxy]benzene;(2-hydroxyethylamino) methanesulfonate |
| SMILES | C=CCOCC(COc1ccc(CCCC)cc1)OCOC.CS(=O)(=O)ONCCO.OCCCCO |
| InChI | InChI=1S/C18H28O4.C4H10O2.C3H9NO4S/c1-4-6-7-16-8-10-17(11-9-16)21-14-18(22-15-19-3)13-20-12-5-2;5-3-1-2-4-6;1-9(6,7)8-4-2-3-5/h5,8-11,18H,2,4,6-7,12-15H2,1,3H3;5-6H,1-4H2;4-5H,2-3H2,1H3 |
| InChIKey | PWLYSJANZPHOKQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|