C21H36NO7PS — CID 91386682
amino [1-(4-nonylphenoxy)-3-prop-2-enoxypropan-2-yl]oxyphosphanyl sulfate (PubChem CID 91386682) has the molecular formula C21H36NO7PS and a molecular weight of 477.56 g/mol. Its IUPAC name is amino [1-(4-nonylphenoxy)-3-prop-2-enoxypropan-2-yl]oxyphosphanyl sulfate.
| Compound Name | amino [1-(4-nonylphenoxy)-3-prop-2-enoxypropan-2-yl]oxyphosphanyl sulfate |
|---|---|
| PubChem CID | 91386682 |
| Molecular Formula | C21H36NO7PS |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | amino [1-(4-nonylphenoxy)-3-prop-2-enoxypropan-2-yl]oxyphosphanyl sulfate |
| SMILES | C=CCOCC(COc1ccc(CCCCCCCCC)cc1)OPOS(=O)(=O)ON |
| InChI | InChI=1S/C21H36NO7PS/c1-3-5-6-7-8-9-10-11-19-12-14-20(15-13-19)26-18-21(17-25-16-4-2)27-30-29-31(23,24)28-22/h4,12-15,21,30H,2-3,5-11,16-18,22H2,1H3 |
| InChIKey | XSRKZMSXAUPKPY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|