C22H34O3 — CID 58827406
CID 58827406 (PubChem CID 58827406) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol.
| Compound Name | CID 58827406 |
|---|---|
| PubChem CID | 58827406 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | — |
| SMILES | [CH]OCC(COc1ccc(CCCCCCCCC)cc1)OCC=C |
| InChI | InChI=1S/C22H34O3/c1-4-6-7-8-9-10-11-12-20-13-15-21(16-14-20)25-19-22(18-23-3)24-17-5-2/h3,5,13-16,22H,2,4,6-12,17-19H2,1H3 |
| InChIKey | ZHWFIGDMQWUTAQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|