C19H30O4 — CID 89345176
1-butyl-4-[2-(2-methoxyethoxy)-3-prop-2-enoxypropoxy]benzene (PubChem CID 89345176) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-butyl-4-[2-(2-methoxyethoxy)-3-prop-2-enoxypropoxy]benzene.
| Compound Name | 1-butyl-4-[2-(2-methoxyethoxy)-3-prop-2-enoxypropoxy]benzene |
|---|---|
| PubChem CID | 89345176 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-butyl-4-[2-(2-methoxyethoxy)-3-prop-2-enoxypropoxy]benzene |
| SMILES | C=CCOCC(COc1ccc(CCCC)cc1)OCCOC |
| InChI | InChI=1S/C19H30O4/c1-4-6-7-17-8-10-18(11-9-17)23-16-19(15-21-12-5-2)22-14-13-20-3/h5,8-11,19H,2,4,6-7,12-16H2,1,3H3 |
| InChIKey | KMMOJMMNYHSZBW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|