C19H28O7S — CID 161491235
methyl [1-(4-butylphenoxy)-4-oxohex-5-en-2-yl]oxymethoxymethanesulfonate (PubChem CID 161491235) has the molecular formula C19H28O7S and a molecular weight of 400.49 g/mol. Its IUPAC name is methyl [1-(4-butylphenoxy)-4-oxohex-5-en-2-yl]oxymethoxymethanesulfonate.
| Compound Name | methyl [1-(4-butylphenoxy)-4-oxohex-5-en-2-yl]oxymethoxymethanesulfonate |
|---|---|
| PubChem CID | 161491235 |
| Molecular Formula | C19H28O7S |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | methyl [1-(4-butylphenoxy)-4-oxohex-5-en-2-yl]oxymethoxymethanesulfonate |
| SMILES | C=CC(=O)CC(COc1ccc(CCCC)cc1)OCOCS(=O)(=O)OC |
| InChI | InChI=1S/C19H28O7S/c1-4-6-7-16-8-10-18(11-9-16)25-13-19(12-17(20)5-2)26-14-24-15-27(21,22)23-3/h5,8-11,19H,2,4,6-7,12-15H2,1,3H3 |
| InChIKey | CAVFBSLGHLUMPK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|