C26H47NO9S — CID 90835853
amino [1-(4-octylphenoxy)-3-prop-2-enoxypropan-2-yl]oxymethoxymethanesulfonate;butane-1,4-diol (PubChem CID 90835853) has the molecular formula C26H47NO9S and a molecular weight of 549.73 g/mol. Its IUPAC name is amino [1-(4-octylphenoxy)-3-prop-2-enoxypropan-2-yl]oxymethoxymethanesulfonate;butane-1,4-diol.
| Compound Name | amino [1-(4-octylphenoxy)-3-prop-2-enoxypropan-2-yl]oxymethoxymethanesulfonate;butane-1,4-diol |
|---|---|
| PubChem CID | 90835853 |
| Molecular Formula | C26H47NO9S |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | amino [1-(4-octylphenoxy)-3-prop-2-enoxypropan-2-yl]oxymethoxymethanesulfonate;butane-1,4-diol |
| SMILES | C=CCOCC(COc1ccc(CCCCCCCC)cc1)OCOCS(=O)(=O)ON.OCCCCO |
| InChI | InChI=1S/C22H37NO7S.C4H10O2/c1-3-5-6-7-8-9-10-20-11-13-21(14-12-20)28-17-22(16-26-15-4-2)29-18-27-19-31(24,25)30-23;5-3-1-2-4-6/h4,11-14,22H,2-3,5-10,15-19,23H2,1H3;5-6H,1-4H2 |
| InChIKey | DPRAAKLTOSUMKG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|