C18H28O4 — CID 20764741
1-butyl-4-[2-(methoxymethoxy)-3-prop-2-enoxypropoxy]benzene (PubChem CID 20764741) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-butyl-4-[2-(methoxymethoxy)-3-prop-2-enoxypropoxy]benzene.
| Compound Name | 1-butyl-4-[2-(methoxymethoxy)-3-prop-2-enoxypropoxy]benzene |
|---|---|
| PubChem CID | 20764741 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 1-butyl-4-[2-(methoxymethoxy)-3-prop-2-enoxypropoxy]benzene |
| SMILES | C=CCOCC(COc1ccc(CCCC)cc1)OCOC |
| InChI | InChI=1S/C18H28O4/c1-4-6-7-16-8-10-17(11-9-16)21-14-18(22-15-19-3)13-20-12-5-2/h5,8-11,18H,2,4,6-7,12-15H2,1,3H3 |
| InChIKey | AEPVLIVVKLORCT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|