C23H36O7S — CID 161491237
methyl [1-(4-octylphenoxy)-4-oxohex-5-en-2-yl]oxymethoxymethanesulfonate (PubChem CID 161491237) has the molecular formula C23H36O7S and a molecular weight of 456.60 g/mol. Its IUPAC name is methyl [1-(4-octylphenoxy)-4-oxohex-5-en-2-yl]oxymethoxymethanesulfonate.
| Compound Name | methyl [1-(4-octylphenoxy)-4-oxohex-5-en-2-yl]oxymethoxymethanesulfonate |
|---|---|
| PubChem CID | 161491237 |
| Molecular Formula | C23H36O7S |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | methyl [1-(4-octylphenoxy)-4-oxohex-5-en-2-yl]oxymethoxymethanesulfonate |
| SMILES | C=CC(=O)CC(COc1ccc(CCCCCCCC)cc1)OCOCS(=O)(=O)OC |
| InChI | InChI=1S/C23H36O7S/c1-4-6-7-8-9-10-11-20-12-14-22(15-13-20)29-17-23(16-21(24)5-2)30-18-28-19-31(25,26)27-3/h5,12-15,23H,2,4,6-11,16-19H2,1,3H3 |
| InChIKey | ANGARYOPPOORTN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|