C7H8F3NO3 — CID 171703353
methyl (Z)-3-hydroxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate (PubChem CID 171703353) has the molecular formula C7H8F3NO3 and a molecular weight of 211.14 g/mol. Its IUPAC name is methyl (Z)-3-hydroxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate.
| Compound Name | methyl (Z)-3-hydroxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate |
|---|---|
| PubChem CID | 171703353 |
| Molecular Formula | C7H8F3NO3 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | methyl (Z)-3-hydroxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate |
| SMILES | [H]/N=C(C(/C(=O)OC)=C(\C)O)\C(F)(F)F |
| InChI | InChI=1S/C7H8F3NO3/c1-3(12)4(6(13)14-2)5(11)7(8,9)10/h11-12H,1-2H3/b4-3-,11-5- |
| InChIKey | RCVQHSKILNKTKL-RUTRJIIFSA-N |
| XLogP | 1.57 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|