C9H12F3NO2 — CID 153192263
ethyl (Z)-2-ethanimidoyl-4,4,4-trifluoro-3-methylbut-2-enoate (PubChem CID 153192263) has the molecular formula C9H12F3NO2 and a molecular weight of 223.19 g/mol. Its IUPAC name is ethyl (Z)-2-ethanimidoyl-4,4,4-trifluoro-3-methylbut-2-enoate.
| Compound Name | ethyl (Z)-2-ethanimidoyl-4,4,4-trifluoro-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 153192263 |
| Molecular Formula | C9H12F3NO2 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | ethyl (Z)-2-ethanimidoyl-4,4,4-trifluoro-3-methylbut-2-enoate |
| SMILES | [H]/N=C(C)/C(C(=O)OCC)=C(\C)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO2/c1-4-15-8(14)7(6(3)13)5(2)9(10,11)12/h13H,4H2,1-3H3/b7-5-,13-6+ |
| InChIKey | WIGULVREKKSGNF-IILXRZLBSA-N |
| XLogP | 2.47 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|