C8H13NO3 — CID 135957281
ethyl (E)-4,4,4-trideuterio-2-ethanimidoyl-3-hydroxybut-2-enoate (PubChem CID 135957281) has the molecular formula C8H13NO3 and a molecular weight of 174.21 g/mol. Its IUPAC name is ethyl (E)-4,4,4-trideuterio-2-ethanimidoyl-3-hydroxybut-2-enoate.
| Compound Name | ethyl (E)-4,4,4-trideuterio-2-ethanimidoyl-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135957281 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | ethyl (E)-4,4,4-trideuterio-2-ethanimidoyl-3-hydroxybut-2-enoate |
| SMILES | [H]/N=C(C)/C(C(=O)OCC)=C(\O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C8H13NO3/c1-4-12-8(11)7(5(2)9)6(3)10/h9-10H,4H2,1-3H3/b7-6+,9-5+/i3D3 |
| InChIKey | RUBQPZODTWDTRT-KKPVURLFSA-N |
| XLogP | 1.42 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|