About cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate)
cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate) (PubChem CID 134899526) has the molecular formula C16H24CoO8
and a molecular weight of 403.29 g/mol. Its IUPAC name is cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate).
Molecular Properties
| Compound Name | cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate) |
| PubChem CID | 134899526 |
| Molecular Formula | C16H24CoO8 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate) |
| SMILES | CCOC(=O)/C(C(C)=O)=C(\C)O.CCOC(=O)/C(C(C)=O)=C(\C)O.[Co] |
| InChI | InChI=1S/2C8H12O4.Co/c2*1-4-12-8(11)7(5(2)9)6(3)10;/h2*9H,4H2,1-3H3;/b2*7-5+; |
| InChIKey | OHJIUPBKSLEDKF-XXXYRMOLSA-N |
| XLogP | 1.94 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate)?
The IUPAC name of cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate) (CID 134899526) is cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate).
What is the SMILES notation for cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate)?
The canonical SMILES for cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate) is CCOC(=O)/C(C(C)=O)=C(\C)O.CCOC(=O)/C(C(C)=O)=C(\C)O.[Co].
What is the InChIKey of cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate)?
The InChIKey is OHJIUPBKSLEDKF-XXXYRMOLSA-N. The full InChI is InChI=1S/2C8H12O4.Co/c2*1-4-12-8(11)7(5(2)9)6(3)10;/h2*9H,4H2,1-3H3;/b2*7-5+;.
What are the key properties of cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate)?
cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate) has a molecular weight of 403.29 g/mol, XLogP of 1.94, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(ethyl (E)-2-acetyl-3-hydroxybut-2-enoate) is sourced from PubChem (CID 134899526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).