C24H32CoO16 — CID 134899629
cobalt;bis(triethyl (E)-1-hydroxy-3-oxoprop-1-ene-1,2,3-tricarboxylate) (PubChem CID 134899629) has the molecular formula C24H32CoO16 and a molecular weight of 635.44 g/mol. Its IUPAC name is cobalt;bis(triethyl (E)-1-hydroxy-3-oxoprop-1-ene-1,2,3-tricarboxylate).
| Compound Name | cobalt;bis(triethyl (E)-1-hydroxy-3-oxoprop-1-ene-1,2,3-tricarboxylate) |
|---|---|
| PubChem CID | 134899629 |
| Molecular Formula | C24H32CoO16 |
| Molecular Weight | 635.44 g/mol |
| Exact Mass | 635.10 |
| IUPAC Name | cobalt;bis(triethyl (E)-1-hydroxy-3-oxoprop-1-ene-1,2,3-tricarboxylate) |
| SMILES | CCOC(=O)C(=O)/C(C(=O)OCC)=C(\O)C(=O)OCC.CCOC(=O)C(=O)/C(C(=O)OCC)=C(\O)C(=O)OCC.[Co] |
| InChI | InChI=1S/2C12H16O8.Co/c2*1-4-18-10(15)7(8(13)11(16)19-5-2)9(14)12(17)20-6-3;/h2*13H,4-6H2,1-3H3;/b2*8-7+; |
| InChIKey | WJYQMDYJWMKJJI-ORWWTJHYSA-N |
| XLogP | 0.11 |
| TPSA | 232.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.44 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|