C8H9F3O4 — CID 146317652
2-ethoxycarbonyl-4,4-difluoro-3-(fluoromethyl)but-2-enoic acid (PubChem CID 146317652) has the molecular formula C8H9F3O4 and a molecular weight of 226.15 g/mol. Its IUPAC name is 2-ethoxycarbonyl-4,4-difluoro-3-(fluoromethyl)but-2-enoic acid.
| Compound Name | 2-ethoxycarbonyl-4,4-difluoro-3-(fluoromethyl)but-2-enoic acid |
|---|---|
| PubChem CID | 146317652 |
| Molecular Formula | C8H9F3O4 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-ethoxycarbonyl-4,4-difluoro-3-(fluoromethyl)but-2-enoic acid |
| SMILES | CCOC(=O)C(C(=O)O)=C(CF)C(F)F |
| InChI | InChI=1S/C8H9F3O4/c1-2-15-8(14)5(7(12)13)4(3-9)6(10)11/h6H,2-3H2,1H3,(H,12,13) |
| InChIKey | JIKKHYNZKZKNBN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|