C8H10F2O4 — CID 131857734
ethyl (Z)-2-acetyl-4,4-difluoro-3-hydroxybut-2-enoate (PubChem CID 131857734) has the molecular formula C8H10F2O4 and a molecular weight of 208.16 g/mol. Its IUPAC name is ethyl (Z)-2-acetyl-4,4-difluoro-3-hydroxybut-2-enoate.
| Compound Name | ethyl (Z)-2-acetyl-4,4-difluoro-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 131857734 |
| Molecular Formula | C8H10F2O4 |
| Molecular Weight | 208.16 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | ethyl (Z)-2-acetyl-4,4-difluoro-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)/C(C(C)=O)=C(\O)C(F)F |
| InChI | InChI=1S/C8H10F2O4/c1-3-14-8(13)5(4(2)11)6(12)7(9)10/h7,12H,3H2,1-2H3/b6-5- |
| InChIKey | FWYLMHWJJJAXOK-WAYWQWQTSA-N |
| XLogP | 1.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.16 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|