C7H8F2NNaO3 — CID 175011945
sodium;ethyl (Z)-2-cyano-4,4-difluoro-3-hydroxybut-2-enoate;hydride (PubChem CID 175011945) has the molecular formula C7H8F2NNaO3 and a molecular weight of 215.13 g/mol. Its IUPAC name is sodium;ethyl (Z)-2-cyano-4,4-difluoro-3-hydroxybut-2-enoate;hydride.
| Compound Name | sodium;ethyl (Z)-2-cyano-4,4-difluoro-3-hydroxybut-2-enoate;hydride |
|---|---|
| PubChem CID | 175011945 |
| Molecular Formula | C7H8F2NNaO3 |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | sodium;ethyl (Z)-2-cyano-4,4-difluoro-3-hydroxybut-2-enoate;hydride |
| SMILES | CCOC(=O)/C(C#N)=C(\O)C(F)F.[H-].[Na+] |
| InChI | InChI=1S/C7H7F2NO3.Na.H/c1-2-13-7(12)4(3-10)5(11)6(8)9;;/h6,11H,2H2,1H3;;/q;+1;-1/b5-4-;; |
| InChIKey | UKLLEAQYCFTHRK-WNCVTPEDSA-N |
| XLogP | -1.73 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|