About CID 159853173
CID 159853173 (PubChem CID 159853173) has the molecular formula C6H7K2NO2S2
and a molecular weight of 267.46 g/mol.
Molecular Properties
| Compound Name | CID 159853173 |
| PubChem CID | 159853173 |
| Molecular Formula | C6H7K2NO2S2 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 266.92 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C(C#N)=C(S)S.[K].[K] |
| InChI | InChI=1S/C6H7NO2S2.2K/c1-2-9-5(8)4(3-7)6(10)11;;/h10-11H,2H2,1H3;; |
| InChIKey | NQEVKSMFCMWWHM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 159853173 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159853173?
The IUPAC name of CID 159853173 (CID 159853173) is not available.
What is the SMILES notation for CID 159853173?
The canonical SMILES for CID 159853173 is CCOC(=O)C(C#N)=C(S)S.[K].[K].
What is the InChIKey of CID 159853173?
The InChIKey is NQEVKSMFCMWWHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S2.2K/c1-2-9-5(8)4(3-7)6(10)11;;/h10-11H,2H2,1H3;;.
What are the key properties of CID 159853173?
CID 159853173 has a molecular weight of 267.46 g/mol, XLogP of 0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159853173 is sourced from PubChem (CID 159853173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).