C10H15NO2 — CID 169440147
ethyl 2-cyano-5,5,5-trideuterio-3-(2,2,2-trideuterioethyl)pent-2-enoate (PubChem CID 169440147) has the molecular formula C10H15NO2 and a molecular weight of 187.27 g/mol. Its IUPAC name is ethyl 2-cyano-5,5,5-trideuterio-3-(2,2,2-trideuterioethyl)pent-2-enoate.
| Compound Name | ethyl 2-cyano-5,5,5-trideuterio-3-(2,2,2-trideuterioethyl)pent-2-enoate |
|---|---|
| PubChem CID | 169440147 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | ethyl 2-cyano-5,5,5-trideuterio-3-(2,2,2-trideuterioethyl)pent-2-enoate |
| SMILES | [2H]C([2H])([2H])CC(CC([2H])([2H])[2H])=C(C#N)C(=O)OCC |
| InChI | InChI=1S/C10H15NO2/c1-4-8(5-2)9(7-11)10(12)13-6-3/h4-6H2,1-3H3/i1D3,2D3 |
| InChIKey | OSEDKDYNLMQYJO-WFGJKAKNSA-N |
| XLogP | 2.19 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|