C12H16O8 — CID 54721815
(Z,3S)-3-acetyloxy-5-ethoxycarbonyl-4-hydroxy-6-oxohept-4-enoic acid (PubChem CID 54721815) has the molecular formula C12H16O8 and a molecular weight of 288.25 g/mol. Its IUPAC name is (Z,3S)-3-acetyloxy-5-ethoxycarbonyl-4-hydroxy-6-oxohept-4-enoic acid.
| Compound Name | (Z,3S)-3-acetyloxy-5-ethoxycarbonyl-4-hydroxy-6-oxohept-4-enoic acid |
|---|---|
| PubChem CID | 54721815 |
| Molecular Formula | C12H16O8 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (Z,3S)-3-acetyloxy-5-ethoxycarbonyl-4-hydroxy-6-oxohept-4-enoic acid |
| SMILES | CCOC(=O)/C(C(C)=O)=C(\O)[C@H](CC(=O)O)OC(C)=O |
| InChI | InChI=1S/C12H16O8/c1-4-19-12(18)10(6(2)13)11(17)8(5-9(15)16)20-7(3)14/h8,17H,4-5H2,1-3H3,(H,15,16)/b11-10-/t8-/m0/s1 |
| InChIKey | AETHYQBGAQJAEE-IZXMIOPHSA-N |
| XLogP | 0.36 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|