C9H12F5NO — CID 12869248
(Z)-5-amino-6,6,7,7,7-pentafluoro-2,2-dimethylhept-4-en-3-one (PubChem CID 12869248) has the molecular formula C9H12F5NO and a molecular weight of 245.19 g/mol. Its IUPAC name is (Z)-5-amino-6,6,7,7,7-pentafluoro-2,2-dimethylhept-4-en-3-one.
| Compound Name | (Z)-5-amino-6,6,7,7,7-pentafluoro-2,2-dimethylhept-4-en-3-one |
|---|---|
| PubChem CID | 12869248 |
| Molecular Formula | C9H12F5NO |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | (Z)-5-amino-6,6,7,7,7-pentafluoro-2,2-dimethylhept-4-en-3-one |
| SMILES | CC(C)(C)C(=O)/C=C(\N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F5NO/c1-7(2,3)6(16)4-5(15)8(10,11)9(12,13)14/h4H,15H2,1-3H3/b5-4- |
| InChIKey | VRZROHXFZXLHDE-PLNGDYQASA-N |
| XLogP | 2.64 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|