C16H26AgF7O2P — CID 146157526
6,6,7,7,8,8,8-heptafluoro-5-hydroxy-2,2-dimethyloct-4-en-3-one;silver;triethylphosphane (PubChem CID 146157526) has the molecular formula C16H26AgF7O2P and a molecular weight of 522.21 g/mol. Its IUPAC name is 6,6,7,7,8,8,8-heptafluoro-5-hydroxy-2,2-dimethyloct-4-en-3-one;silver;triethylphosphane.
| Compound Name | 6,6,7,7,8,8,8-heptafluoro-5-hydroxy-2,2-dimethyloct-4-en-3-one;silver;triethylphosphane |
|---|---|
| PubChem CID | 146157526 |
| Molecular Formula | C16H26AgF7O2P |
| Molecular Weight | 522.21 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 6,6,7,7,8,8,8-heptafluoro-5-hydroxy-2,2-dimethyloct-4-en-3-one;silver;triethylphosphane |
| SMILES | CC(C)(C)C(=O)C=C(O)C(F)(F)C(F)(F)C(F)(F)F.CCP(CC)CC.[Ag] |
| InChI | InChI=1S/C10H11F7O2.C6H15P.Ag/c1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17;1-4-7(5-2)6-3;/h4,19H,1-3H3;4-6H2,1-3H3; |
| InChIKey | SKYWZMHJSXPSEI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.21 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|