C8H11F7O2 — CID 173358412
butane;2,2,3,3,4,4,4-heptafluorobutanoic acid (PubChem CID 173358412) has the molecular formula C8H11F7O2 and a molecular weight of 272.16 g/mol. Its IUPAC name is butane;2,2,3,3,4,4,4-heptafluorobutanoic acid.
| Compound Name | butane;2,2,3,3,4,4,4-heptafluorobutanoic acid |
|---|---|
| PubChem CID | 173358412 |
| Molecular Formula | C8H11F7O2 |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | butane;2,2,3,3,4,4,4-heptafluorobutanoic acid |
| SMILES | CCCC.O=C(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HF7O2.C4H10/c5-2(6,1(12)13)3(7,8)4(9,10)11;1-3-4-2/h(H,12,13);3-4H2,1-2H3 |
| InChIKey | IGSDZPNCGZULGY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|