C7H5F7O2 — CID 12951193
(Z)-5,5,6,6,7,7,7-heptafluoro-4-hydroxyhept-3-en-2-one (PubChem CID 12951193) has the molecular formula C7H5F7O2 and a molecular weight of 254.10 g/mol. Its IUPAC name is (Z)-5,5,6,6,7,7,7-heptafluoro-4-hydroxyhept-3-en-2-one.
| Compound Name | (Z)-5,5,6,6,7,7,7-heptafluoro-4-hydroxyhept-3-en-2-one |
|---|---|
| PubChem CID | 12951193 |
| Molecular Formula | C7H5F7O2 |
| Molecular Weight | 254.10 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | (Z)-5,5,6,6,7,7,7-heptafluoro-4-hydroxyhept-3-en-2-one |
| SMILES | CC(=O)/C=C(\O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F7O2/c1-3(15)2-4(16)5(8,9)6(10,11)7(12,13)14/h2,16H,1H3/b4-2- |
| InChIKey | DQBJUPDAKSMDSK-RQOWECAXSA-N |
| XLogP | 2.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.10 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|