C11H10F7NO4 — CID 71501570
ethyl (2Z,4Z)-6,6,7,7,8,8,8-heptafluoro-2-formamido-5-hydroxyocta-2,4-dienoate (PubChem CID 71501570) has the molecular formula C11H10F7NO4 and a molecular weight of 353.19 g/mol. Its IUPAC name is ethyl (2Z,4Z)-6,6,7,7,8,8,8-heptafluoro-2-formamido-5-hydroxyocta-2,4-dienoate.
| Compound Name | ethyl (2Z,4Z)-6,6,7,7,8,8,8-heptafluoro-2-formamido-5-hydroxyocta-2,4-dienoate |
|---|---|
| PubChem CID | 71501570 |
| Molecular Formula | C11H10F7NO4 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | ethyl (2Z,4Z)-6,6,7,7,8,8,8-heptafluoro-2-formamido-5-hydroxyocta-2,4-dienoate |
| SMILES | CCOC(=O)/C(=C/C=C(\O)C(F)(F)C(F)(F)C(F)(F)F)NC=O |
| InChI | InChI=1S/C11H10F7NO4/c1-2-23-8(22)6(19-5-20)3-4-7(21)9(12,13)10(14,15)11(16,17)18/h3-5,21H,2H2,1H3,(H,19,20)/b6-3-,7-4- |
| InChIKey | SESNRUFSHPUMAI-VKOMYYDGSA-N |
| XLogP | 2.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|