C9H10ClF2NO4 — CID 71501568
ethyl (2Z,4Z)-6-chloro-6,6-difluoro-2-formamido-5-hydroxyhexa-2,4-dienoate (PubChem CID 71501568) has the molecular formula C9H10ClF2NO4 and a molecular weight of 269.63 g/mol. Its IUPAC name is ethyl (2Z,4Z)-6-chloro-6,6-difluoro-2-formamido-5-hydroxyhexa-2,4-dienoate.
| Compound Name | ethyl (2Z,4Z)-6-chloro-6,6-difluoro-2-formamido-5-hydroxyhexa-2,4-dienoate |
|---|---|
| PubChem CID | 71501568 |
| Molecular Formula | C9H10ClF2NO4 |
| Molecular Weight | 269.63 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | ethyl (2Z,4Z)-6-chloro-6,6-difluoro-2-formamido-5-hydroxyhexa-2,4-dienoate |
| SMILES | CCOC(=O)/C(=C/C=C(\O)C(F)(F)Cl)NC=O |
| InChI | InChI=1S/C9H10ClF2NO4/c1-2-17-8(16)6(13-5-14)3-4-7(15)9(10,11)12/h3-5,15H,2H2,1H3,(H,13,14)/b6-3-,7-4- |
| InChIKey | UIASOOVQVRXBLJ-VKOMYYDGSA-N |
| XLogP | 1.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.63 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|