C11H14F3NO4 — CID 71501565
ethyl (2Z,4E)-2-formamido-5-methoxy-3-(trifluoromethyl)hexa-2,4-dienoate (PubChem CID 71501565) has the molecular formula C11H14F3NO4 and a molecular weight of 281.23 g/mol. Its IUPAC name is ethyl (2Z,4E)-2-formamido-5-methoxy-3-(trifluoromethyl)hexa-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-2-formamido-5-methoxy-3-(trifluoromethyl)hexa-2,4-dienoate |
|---|---|
| PubChem CID | 71501565 |
| Molecular Formula | C11H14F3NO4 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | ethyl (2Z,4E)-2-formamido-5-methoxy-3-(trifluoromethyl)hexa-2,4-dienoate |
| SMILES | CCOC(=O)/C(NC=O)=C(\C=C(/C)OC)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO4/c1-4-19-10(17)9(15-6-16)8(11(12,13)14)5-7(2)18-3/h5-6H,4H2,1-3H3,(H,15,16)/b7-5+,9-8- |
| InChIKey | LMWFEFMTOJVNDX-WGKMIZOUSA-N |
| XLogP | 1.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|